C15H17BF2N4O3S — CID 177186337
CID 177186337 (PubChem CID 177186337) has the molecular formula C15H17BF2N4O3S and a molecular weight of 382.20 g/mol.
| Compound Name | CID 177186337 |
|---|---|
| PubChem CID | 177186337 |
| Molecular Formula | C15H17BF2N4O3S |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(F)F)cc2cnc(N[C@@H]3CCN(S(C)(=O)=O)C[C@H]3O)nc12 |
| InChI | InChI=1S/C15H17BF2N4O3S/c1-26(24,25)22-3-2-11(12(23)7-22)20-15-19-6-9-4-8(14(17)18)5-10(16)13(9)21-15/h4-6,11-12,14,23H,2-3,7H2,1H3,(H,19,20,21)/t11-,12-/m1/s1 |
| InChIKey | JKTLEUHCUQMJAF-VXGBXAGGSA-N |
| XLogP | 0.17 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|