C21H29F3N6O2S — CID 170234582
8-N-[(1R)-2,2-difluorocyclopentyl]-6-(1-fluoroethyl)-2-N-[(3R,4S)-3-methyl-1-methylsulfonylpiperidin-4-yl]pyrido[3,4-d]pyrimidine-2,8-diamine (PubChem CID 170234582) has the molecular formula C21H29F3N6O2S and a molecular weight of 486.56 g/mol. Its IUPAC name is 8-N-[(1R)-2,2-difluorocyclopentyl]-6-(1-fluoroethyl)-2-N-[(3R,4S)-3-methyl-1-methylsulfonylpiperidin-4-yl]pyrido[3,4-d]pyrimidine-2,8-diamine.
| Compound Name | 8-N-[(1R)-2,2-difluorocyclopentyl]-6-(1-fluoroethyl)-2-N-[(3R,4S)-3-methyl-1-methylsulfonylpiperidin-4-yl]pyrido[3,4-d]pyrimidine-2,8-diamine |
|---|---|
| PubChem CID | 170234582 |
| Molecular Formula | C21H29F3N6O2S |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 8-N-[(1R)-2,2-difluorocyclopentyl]-6-(1-fluoroethyl)-2-N-[(3R,4S)-3-methyl-1-methylsulfonylpiperidin-4-yl]pyrido[3,4-d]pyrimidine-2,8-diamine |
| SMILES | CC(F)c1cc2cnc(N[C@H]3CCN(S(C)(=O)=O)C[C@H]3C)nc2c(N[C@@H]2CCCC2(F)F)n1 |
| InChI | InChI=1S/C21H29F3N6O2S/c1-12-11-30(33(3,31)32)8-6-15(12)27-20-25-10-14-9-16(13(2)22)26-19(18(14)29-20)28-17-5-4-7-21(17,23)24/h9-10,12-13,15,17H,4-8,11H2,1-3H3,(H,26,28)(H,25,27,29)/t12-,13?,15+,17-/m1/s1 |
| InChIKey | ITHQWOHLXFFFEB-AOEARVSXSA-N |
| XLogP | 3.74 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |