C18H17F4N5O3S — CID 170064306
(3R,4R)-4-[[6-fluoro-7-(2,4,6-trifluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol (PubChem CID 170064306) has the molecular formula C18H17F4N5O3S and a molecular weight of 459.43 g/mol. Its IUPAC name is (3R,4R)-4-[[6-fluoro-7-(2,4,6-trifluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol.
| Compound Name | (3R,4R)-4-[[6-fluoro-7-(2,4,6-trifluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 170064306 |
| Molecular Formula | C18H17F4N5O3S |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | (3R,4R)-4-[[6-fluoro-7-(2,4,6-trifluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol |
| SMILES | CS(=O)(=O)N1CC[C@@H](Nc2ncc3cc(F)c(-c4c(F)cc(F)cc4F)n3n2)[C@H](O)C1 |
| InChI | InChI=1S/C18H17F4N5O3S/c1-31(29,30)26-3-2-14(15(28)8-26)24-18-23-7-10-6-13(22)17(27(10)25-18)16-11(20)4-9(19)5-12(16)21/h4-7,14-15,28H,2-3,8H2,1H3,(H,24,25)/t14-,15-/m1/s1 |
| InChIKey | KQXQWLRLPZKNES-HUUCEWRRSA-N |
| XLogP | 1.76 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |