C18H15F6N5O3S — CID 170062961
(3R,4R)-4-[[5-fluoro-7-(2,3,4,5,6-pentafluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol (PubChem CID 170062961) has the molecular formula C18H15F6N5O3S and a molecular weight of 495.41 g/mol. Its IUPAC name is (3R,4R)-4-[[5-fluoro-7-(2,3,4,5,6-pentafluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol.
| Compound Name | (3R,4R)-4-[[5-fluoro-7-(2,3,4,5,6-pentafluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 170062961 |
| Molecular Formula | C18H15F6N5O3S |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | (3R,4R)-4-[[5-fluoro-7-(2,3,4,5,6-pentafluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol |
| SMILES | CS(=O)(=O)N1CC[C@@H](Nc2ncc3c(F)cc(-c4c(F)c(F)c(F)c(F)c4F)n3n2)[C@H](O)C1 |
| InChI | InChI=1S/C18H15F6N5O3S/c1-33(31,32)28-3-2-8(11(30)6-28)26-18-25-5-10-7(19)4-9(29(10)27-18)12-13(20)15(22)17(24)16(23)14(12)21/h4-5,8,11,30H,2-3,6H2,1H3,(H,26,27)/t8-,11-/m1/s1 |
| InChIKey | VEQBRPUGUAOUNQ-LDYMZIIASA-N |
| XLogP | 2.04 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|