C21H22F4N6O3S — CID 169117737
(3R,4R)-1-cyclopropylsulfonyl-4-[[5-fluoro-7-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol (PubChem CID 169117737) has the molecular formula C21H22F4N6O3S and a molecular weight of 514.51 g/mol. Its IUPAC name is (3R,4R)-1-cyclopropylsulfonyl-4-[[5-fluoro-7-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol.
| Compound Name | (3R,4R)-1-cyclopropylsulfonyl-4-[[5-fluoro-7-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol |
|---|---|
| PubChem CID | 169117737 |
| Molecular Formula | C21H22F4N6O3S |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | (3R,4R)-1-cyclopropylsulfonyl-4-[[5-fluoro-7-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol |
| SMILES | O=S(=O)(C1CC1)N1CC[C@@H](Nc2ncc3c(F)cc(-c4ccc(CC(F)(F)F)cn4)n3n2)[C@H](O)C1 |
| InChI | InChI=1S/C21H22F4N6O3S/c22-14-7-17(15-4-1-12(9-26-15)8-21(23,24)25)31-18(14)10-27-20(29-31)28-16-5-6-30(11-19(16)32)35(33,34)13-2-3-13/h1,4,7,9-10,13,16,19,32H,2-3,5-6,8,11H2,(H,28,29)/t16-,19-/m1/s1 |
| InChIKey | KTNJNQICXNXTNZ-VQIMIIECSA-N |
| XLogP | 2.37 |
| TPSA | 112.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |