C20H20F4N6O4S — CID 170061404
(3R,4R)-1-cyclopropylsulfonyl-4-[[5-fluoro-7-[5-(trifluoromethoxy)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol (PubChem CID 170061404) has the molecular formula C20H20F4N6O4S and a molecular weight of 516.48 g/mol. Its IUPAC name is (3R,4R)-1-cyclopropylsulfonyl-4-[[5-fluoro-7-[5-(trifluoromethoxy)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol.
| Compound Name | (3R,4R)-1-cyclopropylsulfonyl-4-[[5-fluoro-7-[5-(trifluoromethoxy)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol |
|---|---|
| PubChem CID | 170061404 |
| Molecular Formula | C20H20F4N6O4S |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | (3R,4R)-1-cyclopropylsulfonyl-4-[[5-fluoro-7-[5-(trifluoromethoxy)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol |
| SMILES | O=S(=O)(C1CC1)N1CC[C@@H](Nc2ncc3c(F)cc(-c4ccc(OC(F)(F)F)cn4)n3n2)[C@H](O)C1 |
| InChI | InChI=1S/C20H20F4N6O4S/c21-13-7-16(14-4-1-11(8-25-14)34-20(22,23)24)30-17(13)9-26-19(28-30)27-15-5-6-29(10-18(15)31)35(32,33)12-2-3-12/h1,4,7-9,12,15,18,31H,2-3,5-6,10H2,(H,27,28)/t15-,18-/m1/s1 |
| InChIKey | AQBNPFGFYXAAHX-CRAIPNDOSA-N |
| XLogP | 2.17 |
| TPSA | 121.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |