C19H17F6N5O2S — CID 170063850
7-[3-(difluoromethyl)-2,6-difluorophenyl]-5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170063850) has the molecular formula C19H17F6N5O2S and a molecular weight of 493.43 g/mol. Its IUPAC name is 7-[3-(difluoromethyl)-2,6-difluorophenyl]-5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-[3-(difluoromethyl)-2,6-difluorophenyl]-5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170063850 |
| Molecular Formula | C19H17F6N5O2S |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 7-[3-(difluoromethyl)-2,6-difluorophenyl]-5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CS(=O)(=O)N1CC[C@@H](Nc2ncc3c(F)cc(-c4c(F)ccc(C(F)F)c4F)n3n2)[C@H](F)C1 |
| InChI | InChI=1S/C19H17F6N5O2S/c1-33(31,32)29-5-4-13(12(22)8-29)27-19-26-7-15-11(21)6-14(30(15)28-19)16-10(20)3-2-9(17(16)23)18(24)25/h2-3,6-7,12-13,18H,4-5,8H2,1H3,(H,27,28)/t12-,13-/m1/s1 |
| InChIKey | IUAZLWDVGLANGU-CHWSQXEVSA-N |
| XLogP | 3.54 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |