C19H19F5N6O2S — CID 169117179
5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]-7-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 169117179) has the molecular formula C19H19F5N6O2S and a molecular weight of 490.46 g/mol. Its IUPAC name is 5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]-7-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]-7-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 169117179 |
| Molecular Formula | C19H19F5N6O2S |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 5-fluoro-N-[(3R,4R)-3-fluoro-1-methylsulfonylpiperidin-4-yl]-7-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CS(=O)(=O)N1CC[C@@H](Nc2ncc3c(F)cc(-c4ccc(CC(F)(F)F)cn4)n3n2)[C@H](F)C1 |
| InChI | InChI=1S/C19H19F5N6O2S/c1-33(31,32)29-5-4-14(13(21)10-29)27-18-26-9-17-12(20)6-16(30(17)28-18)15-3-2-11(8-25-15)7-19(22,23)24/h2-3,6,8-9,13-14H,4-5,7,10H2,1H3,(H,27,28)/t13-,14-/m1/s1 |
| InChIKey | NZABEAYUEVJPJH-ZIAGYGMSSA-N |
| XLogP | 2.82 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |