C18H25ClF3N7O3S — CID 176688696
(3R,4S)-4-[[5-chloro-7-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]imidazo[5,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol (PubChem CID 176688696) has the molecular formula C18H25ClF3N7O3S and a molecular weight of 511.96 g/mol. Its IUPAC name is (3R,4S)-4-[[5-chloro-7-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]imidazo[5,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol.
| Compound Name | (3R,4S)-4-[[5-chloro-7-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]imidazo[5,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 176688696 |
| Molecular Formula | C18H25ClF3N7O3S |
| Molecular Weight | 511.96 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | (3R,4S)-4-[[5-chloro-7-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]imidazo[5,1-f][1,2,4]triazin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol |
| SMILES | CS(=O)(=O)N1CC[C@H](Nc2ncc3c(Cl)nc(C4CCN(CC(F)(F)F)CC4)n3n2)[C@H](O)C1 |
| InChI | InChI=1S/C18H25ClF3N7O3S/c1-33(31,32)28-7-4-12(14(30)9-28)24-17-23-8-13-15(19)25-16(29(13)26-17)11-2-5-27(6-3-11)10-18(20,21)22/h8,11-12,14,30H,2-7,9-10H2,1H3,(H,24,26)/t12-,14+/m0/s1 |
| InChIKey | KGQDFEBMKHOIMF-GXTWGEPZSA-N |
| XLogP | 1.33 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.96 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |