C18H20N8O3S — CID 169117138
(3R,4R)-1-methylsulfonyl-4-[[7-([1,2,4]triazolo[4,3-a]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol (PubChem CID 169117138) has the molecular formula C18H20N8O3S and a molecular weight of 428.48 g/mol. Its IUPAC name is (3R,4R)-1-methylsulfonyl-4-[[7-([1,2,4]triazolo[4,3-a]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol.
| Compound Name | (3R,4R)-1-methylsulfonyl-4-[[7-([1,2,4]triazolo[4,3-a]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol |
|---|---|
| PubChem CID | 169117138 |
| Molecular Formula | C18H20N8O3S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (3R,4R)-1-methylsulfonyl-4-[[7-([1,2,4]triazolo[4,3-a]pyridin-5-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-3-ol |
| SMILES | CS(=O)(=O)N1CC[C@@H](Nc2ncc3ccc(-c4cccc5nncn45)n3n2)[C@H](O)C1 |
| InChI | InChI=1S/C18H20N8O3S/c1-30(28,29)24-8-7-13(16(27)10-24)21-18-19-9-12-5-6-15(26(12)23-18)14-3-2-4-17-22-20-11-25(14)17/h2-6,9,11,13,16,27H,7-8,10H2,1H3,(H,21,23)/t13-,16-/m1/s1 |
| InChIKey | GSTJDNPGSVZHDA-CZUORRHYSA-N |
| XLogP | 0.25 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |