C25H19F7N6O2 — CID 169118785
4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;7-fluoro-2-hex-5-ynyl-6-[5-(trifluoromethyl)pyrimidin-2-yl]isoquinolin-1-one (PubChem CID 169118785) has the molecular formula C25H19F7N6O2 and a molecular weight of 568.45 g/mol. Its IUPAC name is 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;7-fluoro-2-hex-5-ynyl-6-[5-(trifluoromethyl)pyrimidin-2-yl]isoquinolin-1-one.
| Compound Name | 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;7-fluoro-2-hex-5-ynyl-6-[5-(trifluoromethyl)pyrimidin-2-yl]isoquinolin-1-one |
|---|---|
| PubChem CID | 169118785 |
| Molecular Formula | C25H19F7N6O2 |
| Molecular Weight | 568.45 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;7-fluoro-2-hex-5-ynyl-6-[5-(trifluoromethyl)pyrimidin-2-yl]isoquinolin-1-one |
| SMILES | C#CCCCCn1ccc2cc(-c3ncc(C(F)(F)F)cn3)c(F)cc2c1=O.Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C20H15F4N3O.C5H4F3N3O/c1-2-3-4-5-7-27-8-6-13-9-16(17(21)10-15(13)19(27)28)18-25-11-14(12-26-18)20(22,23)24;6-5(7,8)3-2(9)1-10-11-4(3)12/h1,6,8-12H,3-5,7H2;1H,(H3,9,11,12) |
| InChIKey | HWORITUNYBJEMJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|