C25H22F7N5O2 — CID 169119102
4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;7-fluoro-2-pentyl-6-[5-(trifluoromethyl)-2-pyridinyl]isoquinolin-1-one (PubChem CID 169119102) has the molecular formula C25H22F7N5O2 and a molecular weight of 557.47 g/mol. Its IUPAC name is 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;7-fluoro-2-pentyl-6-[5-(trifluoromethyl)-2-pyridinyl]isoquinolin-1-one.
| Compound Name | 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;7-fluoro-2-pentyl-6-[5-(trifluoromethyl)-2-pyridinyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 169119102 |
| Molecular Formula | C25H22F7N5O2 |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;7-fluoro-2-pentyl-6-[5-(trifluoromethyl)-2-pyridinyl]isoquinolin-1-one |
| SMILES | CCCCCn1ccc2cc(-c3ccc(C(F)(F)F)cn3)c(F)cc2c1=O.Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C20H18F4N2O.C5H4F3N3O/c1-2-3-4-8-26-9-7-13-10-16(17(21)11-15(13)19(26)27)18-6-5-14(12-25-18)20(22,23)24;6-5(7,8)3-2(9)1-10-11-4(3)12/h5-7,9-12H,2-4,8H2,1H3;1H,(H3,9,11,12) |
| InChIKey | AFVKEBKPMMUUEE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|