C27H26F4N4O4 — CID 169118408
4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;6-(2,3-dihydro-1,4-benzodioxin-5-yl)-7-fluoro-2-pentylisoquinolin-1-one (PubChem CID 169118408) has the molecular formula C27H26F4N4O4 and a molecular weight of 546.52 g/mol. Its IUPAC name is 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;6-(2,3-dihydro-1,4-benzodioxin-5-yl)-7-fluoro-2-pentylisoquinolin-1-one.
| Compound Name | 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;6-(2,3-dihydro-1,4-benzodioxin-5-yl)-7-fluoro-2-pentylisoquinolin-1-one |
|---|---|
| PubChem CID | 169118408 |
| Molecular Formula | C27H26F4N4O4 |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;6-(2,3-dihydro-1,4-benzodioxin-5-yl)-7-fluoro-2-pentylisoquinolin-1-one |
| SMILES | CCCCCn1ccc2cc(-c3cccc4c3OCCO4)c(F)cc2c1=O.Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C22H22FNO3.C5H4F3N3O/c1-2-3-4-9-24-10-8-15-13-18(19(23)14-17(15)22(24)25)16-6-5-7-20-21(16)27-12-11-26-20;6-5(7,8)3-2(9)1-10-11-4(3)12/h5-8,10,13-14H,2-4,9,11-12H2,1H3;1H,(H3,9,11,12) |
| InChIKey | RKNWUZHPUYHPTL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|