C25H25F4N5O2S — CID 169119000
4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;8-fluoro-6-(5-methylsulfanyl-2-pyridinyl)-2-pentylisoquinolin-1-one (PubChem CID 169119000) has the molecular formula C25H25F4N5O2S and a molecular weight of 535.57 g/mol. Its IUPAC name is 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;8-fluoro-6-(5-methylsulfanyl-2-pyridinyl)-2-pentylisoquinolin-1-one.
| Compound Name | 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;8-fluoro-6-(5-methylsulfanyl-2-pyridinyl)-2-pentylisoquinolin-1-one |
|---|---|
| PubChem CID | 169119000 |
| Molecular Formula | C25H25F4N5O2S |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | 4-amino-5-(trifluoromethyl)-1H-pyridazin-6-one;8-fluoro-6-(5-methylsulfanyl-2-pyridinyl)-2-pentylisoquinolin-1-one |
| SMILES | CCCCCn1ccc2cc(-c3ccc(SC)cn3)cc(F)c2c1=O.Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C20H21FN2OS.C5H4F3N3O/c1-3-4-5-9-23-10-8-14-11-15(12-17(21)19(14)20(23)24)18-7-6-16(25-2)13-22-18;6-5(7,8)3-2(9)1-10-11-4(3)12/h6-8,10-13H,3-5,9H2,1-2H3;1H,(H3,9,11,12) |
| InChIKey | YFWKRDPCIPURTH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|