C18H20F2N3O4+ — CID 169120023
1-[2,4-difluoro-6-[(4-methoxyphenyl)methoxy]phenyl]-2-oxotriazolidin-2-ium-4-one;ethane (PubChem CID 169120023) has the molecular formula C18H20F2N3O4+ and a molecular weight of 380.37 g/mol. Its IUPAC name is 1-[2,4-difluoro-6-[(4-methoxyphenyl)methoxy]phenyl]-2-oxotriazolidin-2-ium-4-one;ethane.
| Compound Name | 1-[2,4-difluoro-6-[(4-methoxyphenyl)methoxy]phenyl]-2-oxotriazolidin-2-ium-4-one;ethane |
|---|---|
| PubChem CID | 169120023 |
| Molecular Formula | C18H20F2N3O4+ |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[2,4-difluoro-6-[(4-methoxyphenyl)methoxy]phenyl]-2-oxotriazolidin-2-ium-4-one;ethane |
| SMILES | CC.COc1ccc(COc2cc(F)cc(F)c2N2CC(=O)N[N+]2=O)cc1 |
| InChI | InChI=1S/C16H13F2N3O4.C2H6/c1-24-12-4-2-10(3-5-12)9-25-14-7-11(17)6-13(18)16(14)20-8-15(22)19-21(20)23;1-2/h2-7H,8-9H2,1H3;1-2H3/p+1 |
| InChIKey | HKSXXHOMOHCLMC-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|