C17H16FN3O5RfS — CID 169119859
4-(2,4-dioxotriazolidin-2-ium-1-yl)-3-fluoro-5-[(4-methoxyphenyl)methoxy]benzaldehyde;rutherfordium;sulfanide (PubChem CID 169119859) has the molecular formula C17H16FN3O5RfS and a molecular weight of 660.40 g/mol. Its IUPAC name is 4-(2,4-dioxotriazolidin-2-ium-1-yl)-3-fluoro-5-[(4-methoxyphenyl)methoxy]benzaldehyde;rutherfordium;sulfanide.
| Compound Name | 4-(2,4-dioxotriazolidin-2-ium-1-yl)-3-fluoro-5-[(4-methoxyphenyl)methoxy]benzaldehyde;rutherfordium;sulfanide |
|---|---|
| PubChem CID | 169119859 |
| Molecular Formula | C17H16FN3O5RfS |
| Molecular Weight | 660.40 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | 4-(2,4-dioxotriazolidin-2-ium-1-yl)-3-fluoro-5-[(4-methoxyphenyl)methoxy]benzaldehyde;rutherfordium;sulfanide |
| SMILES | COc1ccc(COc2cc(C=O)cc(F)c2N2CC(=O)N[N+]2=O)cc1.[Rf].[SH-] |
| InChI | InChI=1S/C17H14FN3O5.Rf.H2S/c1-25-13-4-2-11(3-5-13)10-26-15-7-12(9-22)6-14(18)17(15)20-8-16(23)19-21(20)24;;/h2-7,9H,8,10H2,1H3;;1H2 |
| InChIKey | FYSVPMLOSMHDKZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|