C18H24FN3O4S — CID 169122678
5-[(1R,8R,10R)-3-fluoro-5-hydroxy-10-(3-methylbutylamino)-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 169122678) has the molecular formula C18H24FN3O4S and a molecular weight of 397.47 g/mol. Its IUPAC name is 5-[(1R,8R,10R)-3-fluoro-5-hydroxy-10-(3-methylbutylamino)-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(1R,8R,10R)-3-fluoro-5-hydroxy-10-(3-methylbutylamino)-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 169122678 |
| Molecular Formula | C18H24FN3O4S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 5-[(1R,8R,10R)-3-fluoro-5-hydroxy-10-(3-methylbutylamino)-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CC(C)CCN[C@@H]1C[C@H]2C[C@@H]1c1c2cc(O)c(N2CC(=O)NS2(=O)=O)c1F |
| InChI | InChI=1S/C18H24FN3O4S/c1-9(2)3-4-20-13-6-10-5-12(13)16-11(10)7-14(23)18(17(16)19)22-8-15(24)21-27(22,25)26/h7,9-10,12-13,20,23H,3-6,8H2,1-2H3,(H,21,24)/t10-,12+,13-/m1/s1 |
| InChIKey | ZWBQTXKXKXGAGT-KGYLQXTDSA-N |
| XLogP | 1.69 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |