C23H22FN5O — CID 169123482
4-[(3aR,6aR)-2-(4-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,6-dimethyl-2-oxo-1,5-naphthyridine-3-carbonitrile (PubChem CID 169123482) has the molecular formula C23H22FN5O and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-[(3aR,6aR)-2-(4-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,6-dimethyl-2-oxo-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 4-[(3aR,6aR)-2-(4-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,6-dimethyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 169123482 |
| Molecular Formula | C23H22FN5O |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 4-[(3aR,6aR)-2-(4-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,6-dimethyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
| SMILES | Cc1ccc2c(n1)c(N1C[C@H]3CN(c4ccc(F)cc4)C[C@@H]3C1)c(C#N)c(=O)n2C |
| InChI | InChI=1S/C23H22FN5O/c1-14-3-8-20-21(26-14)22(19(9-25)23(30)27(20)2)29-12-15-10-28(11-16(15)13-29)18-6-4-17(24)5-7-18/h3-8,15-16H,10-13H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | UGKKTSSAZVTKJM-HZPDHXFCSA-N |
| XLogP | 2.83 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |