C23H19ClF3N5O2 — CID 169123257
4-[(3aS,6aR)-2-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-chloro-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile (PubChem CID 169123257) has the molecular formula C23H19ClF3N5O2 and a molecular weight of 489.89 g/mol. Its IUPAC name is 4-[(3aS,6aR)-2-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-chloro-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 4-[(3aS,6aR)-2-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-chloro-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 169123257 |
| Molecular Formula | C23H19ClF3N5O2 |
| Molecular Weight | 489.89 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 4-[(3aS,6aR)-2-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-chloro-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
| SMILES | Cn1c(=O)c(C#N)c(N2C[C@H]3CN(c4ccc(OC(F)(F)F)cc4)C[C@H]3C2)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C23H19ClF3N5O2/c1-30-18-6-7-19(24)29-20(18)21(17(8-28)22(30)33)32-11-13-9-31(10-14(13)12-32)15-2-4-16(5-3-15)34-23(25,26)27/h2-7,13-14H,9-12H2,1H3/t13-,14+ |
| InChIKey | RORFJQWOPUWUEO-OKILXGFUSA-N |
| XLogP | 3.93 |
| TPSA | 74.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.89 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|