C22H22ClN5O — CID 151095410
6-chloro-1-methyl-4-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-2-oxo-1,5-naphthyridine-3-carbonitrile (PubChem CID 151095410) has the molecular formula C22H22ClN5O and a molecular weight of 407.91 g/mol. Its IUPAC name is 6-chloro-1-methyl-4-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-2-oxo-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 6-chloro-1-methyl-4-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-2-oxo-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 151095410 |
| Molecular Formula | C22H22ClN5O |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 6-chloro-1-methyl-4-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-2-oxo-1,5-naphthyridine-3-carbonitrile |
| SMILES | Cc1ccccc1CN1CCN(c2c(C#N)c(=O)n(C)c3ccc(Cl)nc23)CC1 |
| InChI | InChI=1S/C22H22ClN5O/c1-15-5-3-4-6-16(15)14-27-9-11-28(12-10-27)21-17(13-24)22(29)26(2)18-7-8-19(23)25-20(18)21/h3-8H,9-12,14H2,1-2H3 |
| InChIKey | MMZSDKQPMDAKCI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|