C22H20N6O2 — CID 151612324
8-[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile (PubChem CID 151612324) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 8-[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile.
| Compound Name | 8-[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile |
|---|---|
| PubChem CID | 151612324 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 8-[4-[(2-hydroxyphenyl)methyl]piperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile |
| SMILES | Cn1c(=O)c(C#N)c(N2CCN(Cc3ccccc3O)CC2)c2nc(C#N)ccc21 |
| InChI | InChI=1S/C22H20N6O2/c1-26-18-7-6-16(12-23)25-20(18)21(17(13-24)22(26)30)28-10-8-27(9-11-28)14-15-4-2-3-5-19(15)29/h2-7,29H,8-11,14H2,1H3 |
| InChIKey | QMTLDSYYEHNCOK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|