C21H19ClFN5O2 — CID 151596454
6-chloro-4-[4-[(2-fluoro-6-hydroxyphenyl)methyl]piperazin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile (PubChem CID 151596454) has the molecular formula C21H19ClFN5O2 and a molecular weight of 427.87 g/mol. Its IUPAC name is 6-chloro-4-[4-[(2-fluoro-6-hydroxyphenyl)methyl]piperazin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 6-chloro-4-[4-[(2-fluoro-6-hydroxyphenyl)methyl]piperazin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 151596454 |
| Molecular Formula | C21H19ClFN5O2 |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 6-chloro-4-[4-[(2-fluoro-6-hydroxyphenyl)methyl]piperazin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
| SMILES | Cn1c(=O)c(C#N)c(N2CCN(Cc3c(O)cccc3F)CC2)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C21H19ClFN5O2/c1-26-16-5-6-18(22)25-19(16)20(13(11-24)21(26)30)28-9-7-27(8-10-28)12-14-15(23)3-2-4-17(14)29/h2-6,29H,7-10,12H2,1H3 |
| InChIKey | QJOHKACZSRBXJI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|