C25H25BrN6O — CID 150967349
6-bromo-4-[4-[(1-ethylindol-4-yl)methyl]piperazin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile (PubChem CID 150967349) has the molecular formula C25H25BrN6O and a molecular weight of 505.42 g/mol. Its IUPAC name is 6-bromo-4-[4-[(1-ethylindol-4-yl)methyl]piperazin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 6-bromo-4-[4-[(1-ethylindol-4-yl)methyl]piperazin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 150967349 |
| Molecular Formula | C25H25BrN6O |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 6-bromo-4-[4-[(1-ethylindol-4-yl)methyl]piperazin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
| SMILES | CCn1ccc2c(CN3CCN(c4c(C#N)c(=O)n(C)c5ccc(Br)nc45)CC3)cccc21 |
| InChI | InChI=1S/C25H25BrN6O/c1-3-31-10-9-18-17(5-4-6-20(18)31)16-30-11-13-32(14-12-30)24-19(15-27)25(33)29(2)21-7-8-22(26)28-23(21)24/h4-10H,3,11-14,16H2,1-2H3 |
| InChIKey | LNJDIFYNMYHOEX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|