C22H23Cl2N5O2 — CID 169122812
4-chloro-2-methoxyaniline;6-chloro-1-methyl-2-oxo-4-piperidin-1-yl-1,5-naphthyridine-3-carbonitrile (PubChem CID 169122812) has the molecular formula C22H23Cl2N5O2 and a molecular weight of 460.37 g/mol. Its IUPAC name is 4-chloro-2-methoxyaniline;6-chloro-1-methyl-2-oxo-4-piperidin-1-yl-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 4-chloro-2-methoxyaniline;6-chloro-1-methyl-2-oxo-4-piperidin-1-yl-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 169122812 |
| Molecular Formula | C22H23Cl2N5O2 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 4-chloro-2-methoxyaniline;6-chloro-1-methyl-2-oxo-4-piperidin-1-yl-1,5-naphthyridine-3-carbonitrile |
| SMILES | COc1cc(Cl)ccc1N.Cn1c(=O)c(C#N)c(N2CCCCC2)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C15H15ClN4O.C7H8ClNO/c1-19-11-5-6-12(16)18-13(11)14(10(9-17)15(19)21)20-7-3-2-4-8-20;1-10-7-4-5(8)2-3-6(7)9/h5-6H,2-4,7-8H2,1H3;2-4H,9H2,1H3 |
| InChIKey | MBRSRAHMWYXFJK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|