C22H21ClFN5O2 — CID 169123259
6-chloro-4-[(3S,4R)-4-(4-fluoro-2-hydroxyanilino)-3-methylpiperidin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile (PubChem CID 169123259) has the molecular formula C22H21ClFN5O2 and a molecular weight of 441.89 g/mol. Its IUPAC name is 6-chloro-4-[(3S,4R)-4-(4-fluoro-2-hydroxyanilino)-3-methylpiperidin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 6-chloro-4-[(3S,4R)-4-(4-fluoro-2-hydroxyanilino)-3-methylpiperidin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 169123259 |
| Molecular Formula | C22H21ClFN5O2 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 6-chloro-4-[(3S,4R)-4-(4-fluoro-2-hydroxyanilino)-3-methylpiperidin-1-yl]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
| SMILES | C[C@H]1CN(c2c(C#N)c(=O)n(C)c3ccc(Cl)nc23)CC[C@H]1Nc1ccc(F)cc1O |
| InChI | InChI=1S/C22H21ClFN5O2/c1-12-11-29(8-7-15(12)26-16-4-3-13(24)9-18(16)30)21-14(10-25)22(31)28(2)17-5-6-19(23)27-20(17)21/h3-6,9,12,15,26,30H,7-8,11H2,1-2H3/t12-,15+/m0/s1 |
| InChIKey | VHZAFUZUEHUBAL-SWLSCSKDSA-N |
| XLogP | 3.63 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|