C11H14N4 — CID 169123970
3,4,5-trimethyl-6-(1-methylpyrazol-3-yl)pyridazine (PubChem CID 169123970) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 3,4,5-trimethyl-6-(1-methylpyrazol-3-yl)pyridazine.
| Compound Name | 3,4,5-trimethyl-6-(1-methylpyrazol-3-yl)pyridazine |
|---|---|
| PubChem CID | 169123970 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3,4,5-trimethyl-6-(1-methylpyrazol-3-yl)pyridazine |
| SMILES | Cc1nnc(-c2ccn(C)n2)c(C)c1C |
| InChI | InChI=1S/C11H14N4/c1-7-8(2)11(13-12-9(7)3)10-5-6-15(4)14-10/h5-6H,1-4H3 |
| InChIKey | DMBMOVMRHPLZNZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |