C13H17N3O2 — CID 169125717
6-cyclobutyl-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide (PubChem CID 169125717) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 6-cyclobutyl-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide.
| Compound Name | 6-cyclobutyl-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 169125717 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 6-cyclobutyl-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide |
| SMILES | O=C(NO)c1cnc2c(c1)CN(C1CCC1)CC2 |
| InChI | InChI=1S/C13H17N3O2/c17-13(15-18)9-6-10-8-16(11-2-1-3-11)5-4-12(10)14-7-9/h6-7,11,18H,1-5,8H2,(H,15,17) |
| InChIKey | ZLIUQOCNIUFFHR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|