C18H18BrClN2O — CID 169128462
3-[[[(3Z,5E)-6-bromo-2-methylidenehepta-3,5-dienyl]amino]methyl]-7-chloro-1H-quinolin-2-one (PubChem CID 169128462) has the molecular formula C18H18BrClN2O and a molecular weight of 393.71 g/mol. Its IUPAC name is 3-[[[(3Z,5E)-6-bromo-2-methylidenehepta-3,5-dienyl]amino]methyl]-7-chloro-1H-quinolin-2-one.
| Compound Name | 3-[[[(3Z,5E)-6-bromo-2-methylidenehepta-3,5-dienyl]amino]methyl]-7-chloro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 169128462 |
| Molecular Formula | C18H18BrClN2O |
| Molecular Weight | 393.71 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 3-[[[(3Z,5E)-6-bromo-2-methylidenehepta-3,5-dienyl]amino]methyl]-7-chloro-1H-quinolin-2-one |
| SMILES | C=C(/C=C\C=C(/C)Br)CNCc1cc2ccc(Cl)cc2[nH]c1=O |
| InChI | InChI=1S/C18H18BrClN2O/c1-12(4-3-5-13(2)19)10-21-11-15-8-14-6-7-16(20)9-17(14)22-18(15)23/h3-9,21H,1,10-11H2,2H3,(H,22,23)/b4-3-,13-5+ |
| InChIKey | PZRWUMQJKNYIIQ-FBOMXQGKSA-N |
| XLogP | 4.68 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|