C18H21FN8 — CID 169129832
6-[7-[(Z)-2-amino-1-hydrazinylethenyl]imidazo[1,2-a]pyridin-3-yl]-N-(4-fluoropyrrolidin-3-yl)pyridin-2-amine (PubChem CID 169129832) has the molecular formula C18H21FN8 and a molecular weight of 368.42 g/mol. Its IUPAC name is 6-[7-[(Z)-2-amino-1-hydrazinylethenyl]imidazo[1,2-a]pyridin-3-yl]-N-(4-fluoropyrrolidin-3-yl)pyridin-2-amine.
| Compound Name | 6-[7-[(Z)-2-amino-1-hydrazinylethenyl]imidazo[1,2-a]pyridin-3-yl]-N-(4-fluoropyrrolidin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 169129832 |
| Molecular Formula | C18H21FN8 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 6-[7-[(Z)-2-amino-1-hydrazinylethenyl]imidazo[1,2-a]pyridin-3-yl]-N-(4-fluoropyrrolidin-3-yl)pyridin-2-amine |
| SMILES | N/C=C(\NN)c1ccn2c(-c3cccc(NC4CNCC4F)n3)cnc2c1 |
| InChI | InChI=1S/C18H21FN8/c19-12-8-22-9-15(12)25-17-3-1-2-13(24-17)16-10-23-18-6-11(4-5-27(16)18)14(7-20)26-21/h1-7,10,12,15,22,26H,8-9,20-21H2,(H,24,25)/b14-7- |
| InChIKey | TZJFXYVNSDBENL-AUWJEWJLSA-N |
| XLogP | 0.84 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|