C19H24N8 — CID 169129385
6-[7-[(Z)-2-amino-1-hydrazinylethenyl]imidazo[1,2-a]pyridin-3-yl]-N-piperidin-3-ylpyridin-2-amine (PubChem CID 169129385) has the molecular formula C19H24N8 and a molecular weight of 364.46 g/mol. Its IUPAC name is 6-[7-[(Z)-2-amino-1-hydrazinylethenyl]imidazo[1,2-a]pyridin-3-yl]-N-piperidin-3-ylpyridin-2-amine.
| Compound Name | 6-[7-[(Z)-2-amino-1-hydrazinylethenyl]imidazo[1,2-a]pyridin-3-yl]-N-piperidin-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 169129385 |
| Molecular Formula | C19H24N8 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 6-[7-[(Z)-2-amino-1-hydrazinylethenyl]imidazo[1,2-a]pyridin-3-yl]-N-piperidin-3-ylpyridin-2-amine |
| SMILES | N/C=C(\NN)c1ccn2c(-c3cccc(NC4CCCNC4)n3)cnc2c1 |
| InChI | InChI=1S/C19H24N8/c20-10-16(26-21)13-6-8-27-17(12-23-19(27)9-13)15-4-1-5-18(25-15)24-14-3-2-7-22-11-14/h1,4-6,8-10,12,14,22,26H,2-3,7,11,20-21H2,(H,24,25)/b16-10- |
| InChIKey | BAOGAIDWSRZOOK-YBEGLDIGSA-N |
| XLogP | 1.28 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|