About 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine
6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine (PubChem CID 58303229) has the molecular formula C16H17FN6
and a molecular weight of 312.35 g/mol. Its IUPAC name is 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine |
| PubChem CID | 58303229 |
| Molecular Formula | C16H17FN6 |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine |
| SMILES | Fc1ccn2c(-c3cncc(N[C@@H]4CCCNC4)n3)cnc2c1 |
| InChI | InChI=1S/C16H17FN6/c17-11-3-5-23-14(9-20-16(23)6-11)13-8-19-10-15(22-13)21-12-2-1-4-18-7-12/h3,5-6,8-10,12,18H,1-2,4,7H2,(H,21,22)/t12-/m1/s1 |
| InChIKey | CVMJEZRTPNYZOS-GFCCVEGCSA-N |
| XLogP | 2.09 |
| TPSA | 67.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine?
The IUPAC name of 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine (CID 58303229) is 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine.
What is the SMILES notation for 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine?
The canonical SMILES for 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine is Fc1ccn2c(-c3cncc(N[C@@H]4CCCNC4)n3)cnc2c1.
What is the InChIKey of 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine?
The InChIKey is CVMJEZRTPNYZOS-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H17FN6/c17-11-3-5-23-14(9-20-16(23)6-11)13-8-19-10-15(22-13)21-12-2-1-4-18-7-12/h3,5-6,8-10,12,18H,1-2,4,7H2,(H,21,22)/t12-/m1/s1.
What are the key properties of 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine?
6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine has a molecular weight of 312.35 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-N-[(3R)-piperidin-3-yl]pyrazin-2-amine is sourced from PubChem (CID 58303229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).