About 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine
6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine (PubChem CID 76753406) has the molecular formula C16H20N6S
and a molecular weight of 328.45 g/mol. Its IUPAC name is 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine.
Molecular Properties
| Compound Name | 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine |
| PubChem CID | 76753406 |
| Molecular Formula | C16H20N6S |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine |
| SMILES | CCc1cn2c(-c3cncc(NC4CCCNC4)n3)cnc2s1 |
| InChI | InChI=1S/C16H20N6S/c1-2-12-10-22-14(8-19-16(22)23-12)13-7-18-9-15(21-13)20-11-4-3-5-17-6-11/h7-11,17H,2-6H2,1H3,(H,20,21) |
| InChIKey | VNLGXPWYYRDCCN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine?
The IUPAC name of 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine (CID 76753406) is 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine.
What is the SMILES notation for 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine?
The canonical SMILES for 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine is CCc1cn2c(-c3cncc(NC4CCCNC4)n3)cnc2s1.
What is the InChIKey of 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine?
The InChIKey is VNLGXPWYYRDCCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N6S/c1-2-12-10-22-14(8-19-16(22)23-12)13-7-18-9-15(21-13)20-11-4-3-5-17-6-11/h7-11,17H,2-6H2,1H3,(H,20,21).
What are the key properties of 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine?
6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine has a molecular weight of 328.45 g/mol, XLogP of 2.58, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-ethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-piperidin-3-ylpyrazin-2-amine is sourced from PubChem (CID 76753406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).