C22H29N5O2 — CID 169130118
tert-butyl 4-(1-methylpyrazol-3-yl)-2-[(3E)-penta-1,3-dien-3-yl]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate;ethene (PubChem CID 169130118) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is tert-butyl 4-(1-methylpyrazol-3-yl)-2-[(3E)-penta-1,3-dien-3-yl]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate;ethene.
| Compound Name | tert-butyl 4-(1-methylpyrazol-3-yl)-2-[(3E)-penta-1,3-dien-3-yl]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate;ethene |
|---|---|
| PubChem CID | 169130118 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | tert-butyl 4-(1-methylpyrazol-3-yl)-2-[(3E)-penta-1,3-dien-3-yl]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate;ethene |
| SMILES | C=C.C=C/C(=C\C)c1nc2c(c(-c3ccn(C)n3)n1)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C20H25N5O2.C2H4/c1-7-13(8-2)18-21-16-12-25(19(26)27-20(3,4)5)11-14(16)17(22-18)15-9-10-24(6)23-15;1-2/h7-10H,1,11-12H2,2-6H3;1-2H2/b13-8+; |
| InChIKey | VLQCHOOVGPUJKT-FNXZNAJJSA-N |
| XLogP | 4.52 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|