C12H8ClF2NO3 — CID 169130704
methyl 2-chloro-3,8-difluoro-4-methoxyquinoline-7-carboxylate (PubChem CID 169130704) has the molecular formula C12H8ClF2NO3 and a molecular weight of 287.65 g/mol. Its IUPAC name is methyl 2-chloro-3,8-difluoro-4-methoxyquinoline-7-carboxylate.
| Compound Name | methyl 2-chloro-3,8-difluoro-4-methoxyquinoline-7-carboxylate |
|---|---|
| PubChem CID | 169130704 |
| Molecular Formula | C12H8ClF2NO3 |
| Molecular Weight | 287.65 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | methyl 2-chloro-3,8-difluoro-4-methoxyquinoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(OC)c(F)c(Cl)nc2c1F |
| InChI | InChI=1S/C12H8ClF2NO3/c1-18-10-6-4-3-5(12(17)19-2)7(14)9(6)16-11(13)8(10)15/h3-4H,1-2H3 |
| InChIKey | UFPUCAKEFRTFTA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|