C33H30BN3O2P — CID 169131625
CID 169131625 (PubChem CID 169131625) has the molecular formula C33H30BN3O2P and a molecular weight of 542.41 g/mol.
| Compound Name | CID 169131625 |
|---|---|
| PubChem CID | 169131625 |
| Molecular Formula | C33H30BN3O2P |
| Molecular Weight | 542.41 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | — |
| SMILES | CC(C)(P)C(C)(C)O[B]c1ccc2oc3c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cccc3c2c1 |
| InChI | InChI=1S/C33H30BN3O2P/c1-32(2,33(3,4)40)39-34-23-18-19-27-26(20-23)24-16-11-17-25(28(24)38-27)31-36-29(21-12-7-5-8-13-21)35-30(37-31)22-14-9-6-10-15-22/h5-20H,40H2,1-4H3 |
| InChIKey | YIFIDZAICKMHDR-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.41 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|