About CID 169131814
CID 169131814 (PubChem CID 169131814) has the molecular formula C42H14B14N2
and a molecular weight of 697.96 g/mol.
Molecular Properties
| Compound Name | CID 169131814 |
| PubChem CID | 169131814 |
| Molecular Formula | C42H14B14N2 |
| Molecular Weight | 697.96 g/mol |
| Exact Mass | 700.25 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2c([B])c([B])c([B])c(-n3c4ccccc4c4cc(-c5ccc6c(c5)c5ccccc5n6-c5c([B])c([B])c([B])c([B])c5[B])ccc43)c2[B])c([B])c1[B] |
| InChI | InChI=1S/C42H14B14N2/c43-27-25(28(44)32(48)34(50)31(27)47)26-29(45)33(49)38(54)41(30(26)46)57-21-7-3-1-5-17(21)19-13-15(9-11-23(19)57)16-10-12-24-20(14-16)18-6-2-4-8-22(18)58(24)42-39(55)36(52)35(51)37(53)40(42)56/h1-14H |
| InChIKey | YLSWTFRFUHCHCU-UHFFFAOYSA-N |
| XLogP | -5.67 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 697.96 |
| LogP ≤ 5 | -5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169131814 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169131814?
The IUPAC name of CID 169131814 (CID 169131814) is not available.
What is the SMILES notation for CID 169131814?
The canonical SMILES for CID 169131814 is [B]c1c([B])c([B])c(-c2c([B])c([B])c([B])c(-n3c4ccccc4c4cc(-c5ccc6c(c5)c5ccccc5n6-c5c([B])c([B])c([B])c([B])c5[B])ccc43)c2[B])c([B])c1[B].
What is the InChIKey of CID 169131814?
The InChIKey is YLSWTFRFUHCHCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H14B14N2/c43-27-25(28(44)32(48)34(50)31(27)47)26-29(45)33(49)38(54)41(30(26)46)57-21-7-3-1-5-17(21)19-13-15(9-11-23(19)57)16-10-12-24-20(14-16)18-6-2-4-8-22(18)58(24)42-39(55)36(52)35(51)37(53)40(42)56/h1-14H.
What are the key properties of CID 169131814?
CID 169131814 has a molecular weight of 697.96 g/mol, XLogP of -5.67, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169131814 is sourced from PubChem (CID 169131814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).