About CID 176994496
CID 176994496 (PubChem CID 176994496) has the molecular formula C42H10B18N2
and a molecular weight of 737.17 g/mol.
Molecular Properties
| Compound Name | CID 176994496 |
| PubChem CID | 176994496 |
| Molecular Formula | C42H10B18N2 |
| Molecular Weight | 737.17 g/mol |
| Exact Mass | 740.25 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2c([B])c([B])c(-n3c4ccccc4c4c5c6ccccc6n(-c6c([B])c([B])c(-c7c([B])c([B])c([B])c([B])c7[B])c([B])c6[B])c5ccc43)c([B])c2[B])c([B])c1[B] |
| InChI | InChI=1S/C42H10B18N2/c43-23-19(24(44)32(52)35(55)31(23)51)21-27(47)37(57)41(38(58)28(21)48)61-13-7-3-1-5-11(13)17-15(61)9-10-16-18(17)12-6-2-4-8-14(12)62(16)42-39(59)29(49)22(30(50)40(42)60)20-25(45)33(53)36(56)34(54)26(20)46/h1-10H |
| InChIKey | TXEHXZLACQWIGO-UHFFFAOYSA-N |
| XLogP | -10.50 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 737.17 |
| LogP ≤ 5 | -10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176994496 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176994496?
The IUPAC name of CID 176994496 (CID 176994496) is not available.
What is the SMILES notation for CID 176994496?
The canonical SMILES for CID 176994496 is [B]c1c([B])c([B])c(-c2c([B])c([B])c(-n3c4ccccc4c4c5c6ccccc6n(-c6c([B])c([B])c(-c7c([B])c([B])c([B])c([B])c7[B])c([B])c6[B])c5ccc43)c([B])c2[B])c([B])c1[B].
What is the InChIKey of CID 176994496?
The InChIKey is TXEHXZLACQWIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H10B18N2/c43-23-19(24(44)32(52)35(55)31(23)51)21-27(47)37(57)41(38(58)28(21)48)61-13-7-3-1-5-11(13)17-15(61)9-10-16-18(17)12-6-2-4-8-14(12)62(16)42-39(59)29(49)22(30(50)40(42)60)20-25(45)33(53)36(56)34(54)26(20)46/h1-10H.
What are the key properties of CID 176994496?
CID 176994496 has a molecular weight of 737.17 g/mol, XLogP of -10.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176994496 is sourced from PubChem (CID 176994496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).