C25H37N7O3 — CID 169132021
tert-butyl 3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-methylpurin-6-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 169132021) has the molecular formula C25H37N7O3 and a molecular weight of 483.62 g/mol. Its IUPAC name is tert-butyl 3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-methylpurin-6-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-methylpurin-6-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 169132021 |
| Molecular Formula | C25H37N7O3 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | tert-butyl 3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-methylpurin-6-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Cn1cnc2nc(OCC34CCCN3CCC4)nc(N3CC4CCC(C3)N4C(=O)OC(C)(C)C)c21 |
| InChI | InChI=1S/C25H37N7O3/c1-24(2,3)35-23(33)32-17-7-8-18(32)14-30(13-17)21-19-20(26-16-29(19)4)27-22(28-21)34-15-25-9-5-11-31(25)12-6-10-25/h16-18H,5-15H2,1-4H3 |
| InChIKey | VWXYHUPDHBTRBM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |