C23H22BrN5O2 — CID 169132897
5-bromo-3-[3-[2-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethoxyimino]indol-2-yl]-1H-indol-2-ol (PubChem CID 169132897) has the molecular formula C23H22BrN5O2 and a molecular weight of 480.37 g/mol. Its IUPAC name is 5-bromo-3-[3-[2-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethoxyimino]indol-2-yl]-1H-indol-2-ol.
| Compound Name | 5-bromo-3-[3-[2-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethoxyimino]indol-2-yl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 169132897 |
| Molecular Formula | C23H22BrN5O2 |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 5-bromo-3-[3-[2-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethoxyimino]indol-2-yl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccc(Br)cc2c1C1=Nc2ccccc2C1=NOCCN1C[C@@H]2C[C@H]1CN2 |
| InChI | InChI=1S/C23H22BrN5O2/c24-13-5-6-19-17(9-13)20(23(30)27-19)22-21(16-3-1-2-4-18(16)26-22)28-31-8-7-29-12-14-10-15(29)11-25-14/h1-6,9,14-15,25,27,30H,7-8,10-12H2/t14-,15-/m0/s1 |
| InChIKey | VXXNBCPJCJPZJJ-GJZGRUSLSA-N |
| XLogP | 3.54 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|