C33H29B3F2N6O3S — CID 169134107
CID 169134107 (PubChem CID 169134107) has the molecular formula C33H29B3F2N6O3S and a molecular weight of 660.13 g/mol.
| Compound Name | CID 169134107 |
|---|---|
| PubChem CID | 169134107 |
| Molecular Formula | C33H29B3F2N6O3S |
| Molecular Weight | 660.13 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CCn2nc(-c3nc(-c4ccc5c(cnn5C)c4)c4ccsc4c3C=C(F)/C=C/F)cc2C1.[B]C([B])([B])OCCOC=C |
| InChI | InChI=1S/C28H22F2N6OS.C5H7B3O2/c1-3-25(37)35-9-10-36-20(16-35)14-23(33-36)27-22(13-19(30)6-8-29)28-21(7-11-38-28)26(32-27)17-4-5-24-18(12-17)15-31-34(24)2;1-2-9-3-4-10-5(6,7)8/h3-8,11-15H,1,9-10,16H2,2H3;2H,1,3-4H2/b8-6+,19-13?; |
| InChIKey | GIIMKILTTNARNW-IQGDUJCQSA-N |
| XLogP | 5.32 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.13 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|