C32H36F2N6O2S — CID 176702369
4-[(3E)-2,4-difluorobuta-1,3-dienyl]-7-(1-methylindazol-5-yl)-5-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)thieno[2,3-c]pyridine;ethane;1-ethenoxy-2-methoxyethane (PubChem CID 176702369) has the molecular formula C32H36F2N6O2S and a molecular weight of 606.74 g/mol. Its IUPAC name is 4-[(3E)-2,4-difluorobuta-1,3-dienyl]-7-(1-methylindazol-5-yl)-5-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)thieno[2,3-c]pyridine;ethane;1-ethenoxy-2-methoxyethane.
| Compound Name | 4-[(3E)-2,4-difluorobuta-1,3-dienyl]-7-(1-methylindazol-5-yl)-5-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)thieno[2,3-c]pyridine;ethane;1-ethenoxy-2-methoxyethane |
|---|---|
| PubChem CID | 176702369 |
| Molecular Formula | C32H36F2N6O2S |
| Molecular Weight | 606.74 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | 4-[(3E)-2,4-difluorobuta-1,3-dienyl]-7-(1-methylindazol-5-yl)-5-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)thieno[2,3-c]pyridine;ethane;1-ethenoxy-2-methoxyethane |
| SMILES | C=COCCOC.CC.Cn1ncc2cc(-c3nc(-c4cc5n(n4)CCNC5)c(C=C(F)/C=C/F)c4ccsc34)ccc21 |
| InChI | InChI=1S/C25H20F2N6S.C5H10O2.C2H6/c1-32-22-3-2-15(10-16(22)13-29-32)23-25-19(5-9-34-25)20(11-17(27)4-6-26)24(30-23)21-12-18-14-28-7-8-33(18)31-21;1-3-7-5-4-6-2;1-2/h2-6,9-13,28H,7-8,14H2,1H3;3H,1,4-5H2,2H3;1-2H3/b6-4+,17-11?;; |
| InChIKey | HZUKEGWSWDSSIQ-XDWRUKCRSA-N |
| XLogP | 7.43 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.74 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|