C14H33N3S — CID 169135386
ethane;1-(2-ethyl-5-methylpyrazol-3-yl)-N,N-dimethylmethanamine;methanethiol (PubChem CID 169135386) has the molecular formula C14H33N3S and a molecular weight of 275.51 g/mol. Its IUPAC name is ethane;1-(2-ethyl-5-methylpyrazol-3-yl)-N,N-dimethylmethanamine;methanethiol.
| Compound Name | ethane;1-(2-ethyl-5-methylpyrazol-3-yl)-N,N-dimethylmethanamine;methanethiol |
|---|---|
| PubChem CID | 169135386 |
| Molecular Formula | C14H33N3S |
| Molecular Weight | 275.51 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | ethane;1-(2-ethyl-5-methylpyrazol-3-yl)-N,N-dimethylmethanamine;methanethiol |
| SMILES | CC.CC.CCn1nc(C)cc1CN(C)C.CS |
| InChI | InChI=1S/C9H17N3.2C2H6.CH4S/c1-5-12-9(7-11(3)4)6-8(2)10-12;3*1-2/h6H,5,7H2,1-4H3;2*1-2H3;2H,1H3 |
| InChIKey | LEAOJIAPDVDLDT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 21.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|