C35H34F2N6O4S — CID 169136217
3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-[5-[(1R)-1-(prop-2-enoylamino)ethyl]-1H-pyrazol-3-yl]thieno[3,2-c]pyridin-4-yl]-N-(1-methylazetidin-3-yl)benzamide (PubChem CID 169136217) has the molecular formula C35H34F2N6O4S and a molecular weight of 672.76 g/mol. Its IUPAC name is 3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-[5-[(1R)-1-(prop-2-enoylamino)ethyl]-1H-pyrazol-3-yl]thieno[3,2-c]pyridin-4-yl]-N-(1-methylazetidin-3-yl)benzamide.
| Compound Name | 3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-[5-[(1R)-1-(prop-2-enoylamino)ethyl]-1H-pyrazol-3-yl]thieno[3,2-c]pyridin-4-yl]-N-(1-methylazetidin-3-yl)benzamide |
|---|---|
| PubChem CID | 169136217 |
| Molecular Formula | C35H34F2N6O4S |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | 3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-[5-[(1R)-1-(prop-2-enoylamino)ethyl]-1H-pyrazol-3-yl]thieno[3,2-c]pyridin-4-yl]-N-(1-methylazetidin-3-yl)benzamide |
| SMILES | C=CC(=O)N[C@H](C)c1cc(-c2nc(-c3cccc(C(=O)NC4CN(C)C4)c3)c3ccsc3c2-c2c(F)cc(F)cc2OCCOC)n[nH]1 |
| InChI | InChI=1S/C35H34F2N6O4S/c1-5-29(44)38-19(2)26-16-27(42-41-26)33-31(30-25(37)14-22(36)15-28(30)47-11-10-46-4)34-24(9-12-48-34)32(40-33)20-7-6-8-21(13-20)35(45)39-23-17-43(3)18-23/h5-9,12-16,19,23H,1,10-11,17-18H2,2-4H3,(H,38,44)(H,39,45)(H,41,42)/t19-/m1/s1 |
| InChIKey | KPCYEKGLQCFVQI-LJQANCHMSA-N |
| XLogP | 5.73 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|