C32H27F3N6O3S — CID 170112212
N-[1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(6-fluoro-1-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]ethyl]prop-2-enamide (PubChem CID 170112212) has the molecular formula C32H27F3N6O3S and a molecular weight of 632.67 g/mol. Its IUPAC name is N-[1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(6-fluoro-1-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]ethyl]prop-2-enamide.
| Compound Name | N-[1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(6-fluoro-1-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 170112212 |
| Molecular Formula | C32H27F3N6O3S |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | N-[1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(6-fluoro-1-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)c1cc(-c2nc(-c3cc4cnn(C)c4cc3F)c3ccsc3c2-c2c(F)cc(F)cc2OCCOC)n[nH]1 |
| InChI | InChI=1S/C32H27F3N6O3S/c1-5-27(42)37-16(2)23-14-24(40-39-23)31-29(28-22(35)11-18(33)12-26(28)44-8-7-43-4)32-19(6-9-45-32)30(38-31)20-10-17-15-36-41(3)25(17)13-21(20)34/h5-6,9-16H,1,7-8H2,2-4H3,(H,37,42)(H,39,40) |
| InChIKey | GFWLAKZKCSCXOK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|