About 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane
2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane (PubChem CID 169137162) has the molecular formula C16H23F3O3
and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane.
Molecular Properties
| Compound Name | 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane |
| PubChem CID | 169137162 |
| Molecular Formula | C16H23F3O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane |
| SMILES | C=C/C=C(\C=C)COC(C=O)(CC=C)C(F)(F)F.CCOC |
| InChI | InChI=1S/C13H15F3O2.C3H8O/c1-4-7-11(6-3)9-18-12(10-17,8-5-2)13(14,15)16;1-3-4-2/h4-7,10H,1-3,8-9H2;3H2,1-2H3/b11-7+; |
| InChIKey | QTTSHXBZYFDBRK-RVDQCCQOSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane?
The IUPAC name of 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane (CID 169137162) is 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane.
What is the SMILES notation for 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane?
The canonical SMILES for 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane is C=C/C=C(\C=C)COC(C=O)(CC=C)C(F)(F)F.CCOC.
What is the InChIKey of 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane?
The InChIKey is QTTSHXBZYFDBRK-RVDQCCQOSA-N. The full InChI is InChI=1S/C13H15F3O2.C3H8O/c1-4-7-11(6-3)9-18-12(10-17,8-5-2)13(14,15)16;1-3-4-2/h4-7,10H,1-3,8-9H2;3H2,1-2H3/b11-7+;.
What are the key properties of 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane?
2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane has a molecular weight of 320.35 g/mol, XLogP of 4.03, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enal;methoxyethane is sourced from PubChem (CID 169137162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).