C15H19F3O3 — CID 169137435
ethyl 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enoate (PubChem CID 169137435) has the molecular formula C15H19F3O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is ethyl 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | ethyl 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 169137435 |
| Molecular Formula | C15H19F3O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | ethyl 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)pent-4-enoate |
| SMILES | C=C/C=C(\C=C)COC(CC=C)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C15H19F3O3/c1-5-9-12(7-3)11-21-14(10-6-2,15(16,17)18)13(19)20-8-4/h5-7,9H,1-3,8,10-11H2,4H3/b12-9+ |
| InChIKey | KZONAZVALRWMJT-FMIVXFBMSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|