C16H21F3O3 — CID 162726624
ethyl 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)hex-5-enoate (PubChem CID 162726624) has the molecular formula C16H21F3O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is ethyl 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)hex-5-enoate.
| Compound Name | ethyl 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)hex-5-enoate |
|---|---|
| PubChem CID | 162726624 |
| Molecular Formula | C16H21F3O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | ethyl 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(trifluoromethyl)hex-5-enoate |
| SMILES | C=C/C=C(\C=C)COC(CCC=C)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C16H21F3O3/c1-5-9-11-15(16(17,18)19,14(20)21-8-4)22-12-13(7-3)10-6-2/h5-7,10H,1-3,8-9,11-12H2,4H3/b13-10+ |
| InChIKey | IQSANYJNAPNXIH-JLHYYAGUSA-N |
| XLogP | 4.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|