C9H11F3O3 — CID 7323300
methyl (6R)-4-methyl-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate (PubChem CID 7323300) has the molecular formula C9H11F3O3 and a molecular weight of 224.18 g/mol. Its IUPAC name is methyl (6R)-4-methyl-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate.
| Compound Name | methyl (6R)-4-methyl-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 7323300 |
| Molecular Formula | C9H11F3O3 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | methyl (6R)-4-methyl-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate |
| SMILES | COC(=O)[C@@]1(C(F)(F)F)CC(C)=CCO1 |
| InChI | InChI=1S/C9H11F3O3/c1-6-3-4-15-8(5-6,7(13)14-2)9(10,11)12/h3H,4-5H2,1-2H3/t8-/m1/s1 |
| InChIKey | QGAOROYWZNPGAX-MRVPVSSYSA-N |
| XLogP | 1.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|