C10H13F3O3 — CID 7323302
methyl (6R)-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate (PubChem CID 7323302) has the molecular formula C10H13F3O3 and a molecular weight of 238.20 g/mol. Its IUPAC name is methyl (6R)-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate.
| Compound Name | methyl (6R)-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 7323302 |
| Molecular Formula | C10H13F3O3 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | methyl (6R)-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate |
| SMILES | COC(=O)[C@@]1(C(F)(F)F)CC(C)=C(C)CO1 |
| InChI | InChI=1S/C10H13F3O3/c1-6-4-9(8(14)15-3,10(11,12)13)16-5-7(6)2/h4-5H2,1-3H3/t9-/m1/s1 |
| InChIKey | JXWPSSTYUHCORO-SECBINFHSA-N |
| XLogP | 2.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|