C12H20N2O3 — CID 169138373
1-methylpyrazole-4-carbaldehyde;2,2,4,4-tetramethyl-1,3-dioxolane (PubChem CID 169138373) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-methylpyrazole-4-carbaldehyde;2,2,4,4-tetramethyl-1,3-dioxolane.
| Compound Name | 1-methylpyrazole-4-carbaldehyde;2,2,4,4-tetramethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 169138373 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-methylpyrazole-4-carbaldehyde;2,2,4,4-tetramethyl-1,3-dioxolane |
| SMILES | CC1(C)COC(C)(C)O1.Cn1cc(C=O)cn1 |
| InChI | InChI=1S/C7H14O2.C5H6N2O/c1-6(2)5-8-7(3,4)9-6;1-7-3-5(4-8)2-6-7/h5H2,1-4H3;2-4H,1H3 |
| InChIKey | YOCXUOJNNUTULT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|